C29H33N5O2S — CID 54046953
2-[2-hydroxyethyl-[3-[[4-[7-(1H-indol-5-ylamino)thieno[2,3-c]pyridin-2-yl]phenyl]methylamino]propyl]amino]ethanol (PubChem CID 54046953) has the molecular formula C29H33N5O2S and a molecular weight of 515.68 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[3-[[4-[7-(1H-indol-5-ylamino)thieno[2,3-c]pyridin-2-yl]phenyl]methylamino]propyl]amino]ethanol.
| Compound Name | 2-[2-hydroxyethyl-[3-[[4-[7-(1H-indol-5-ylamino)thieno[2,3-c]pyridin-2-yl]phenyl]methylamino]propyl]amino]ethanol |
|---|---|
| PubChem CID | 54046953 |
| Molecular Formula | C29H33N5O2S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 2-[2-hydroxyethyl-[3-[[4-[7-(1H-indol-5-ylamino)thieno[2,3-c]pyridin-2-yl]phenyl]methylamino]propyl]amino]ethanol |
| SMILES | OCCN(CCO)CCCNCc1ccc(-c2cc3ccnc(Nc4ccc5[nH]ccc5c4)c3s2)cc1 |
| InChI | InChI=1S/C29H33N5O2S/c35-16-14-34(15-17-36)13-1-10-30-20-21-2-4-22(5-3-21)27-19-24-9-12-32-29(28(24)37-27)33-25-6-7-26-23(18-25)8-11-31-26/h2-9,11-12,18-19,30-31,35-36H,1,10,13-17,20H2,(H,32,33) |
| InChIKey | LQFXHLBMDSUIJX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|