C27H24N6OS — CID 69472652
1-butyl-3-[4-[5-cyano-4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]phenyl]urea (PubChem CID 69472652) has the molecular formula C27H24N6OS and a molecular weight of 480.60 g/mol. Its IUPAC name is 1-butyl-3-[4-[5-cyano-4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]phenyl]urea.
| Compound Name | 1-butyl-3-[4-[5-cyano-4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 69472652 |
| Molecular Formula | C27H24N6OS |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 1-butyl-3-[4-[5-cyano-4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]phenyl]urea |
| SMILES | CCCCNC(=O)Nc1ccc(-c2cc3c(Nc4ccc5[nH]ccc5c4)c(C#N)cnc3s2)cc1 |
| InChI | InChI=1S/C27H24N6OS/c1-2-3-11-30-27(34)33-20-6-4-17(5-7-20)24-14-22-25(19(15-28)16-31-26(22)35-24)32-21-8-9-23-18(13-21)10-12-29-23/h4-10,12-14,16,29H,2-3,11H2,1H3,(H,31,32)(H2,30,33,34) |
| InChIKey | JXCSXERPYADKKN-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 105.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|