C20H14N4S — CID 86611805
2-[(1E)-buta-1,3-dienyl]-4-(1H-indol-5-ylamino)thieno[2,3-b]pyridine-5-carbonitrile (PubChem CID 86611805) has the molecular formula C20H14N4S and a molecular weight of 342.43 g/mol. Its IUPAC name is 2-[(1E)-buta-1,3-dienyl]-4-(1H-indol-5-ylamino)thieno[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 2-[(1E)-buta-1,3-dienyl]-4-(1H-indol-5-ylamino)thieno[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 86611805 |
| Molecular Formula | C20H14N4S |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[(1E)-buta-1,3-dienyl]-4-(1H-indol-5-ylamino)thieno[2,3-b]pyridine-5-carbonitrile |
| SMILES | C=C/C=C/c1cc2c(Nc3ccc4[nH]ccc4c3)c(C#N)cnc2s1 |
| InChI | InChI=1S/C20H14N4S/c1-2-3-4-16-10-17-19(14(11-21)12-23-20(17)25-16)24-15-5-6-18-13(9-15)7-8-22-18/h2-10,12,22H,1H2,(H,23,24)/b4-3+ |
| InChIKey | FOPQQNFMNPKTQJ-ONEGZZNKSA-N |
| XLogP | 5.59 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|