C24H22N6OS — CID 69471102
4-[(4-methyl-1H-indol-5-yl)amino]-2-(3-oxo-3-piperazin-1-ylprop-1-enyl)thieno[2,3-b]pyridine-5-carbonitrile (PubChem CID 69471102) has the molecular formula C24H22N6OS and a molecular weight of 442.55 g/mol. Its IUPAC name is 4-[(4-methyl-1H-indol-5-yl)amino]-2-(3-oxo-3-piperazin-1-ylprop-1-enyl)thieno[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 4-[(4-methyl-1H-indol-5-yl)amino]-2-(3-oxo-3-piperazin-1-ylprop-1-enyl)thieno[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 69471102 |
| Molecular Formula | C24H22N6OS |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-[(4-methyl-1H-indol-5-yl)amino]-2-(3-oxo-3-piperazin-1-ylprop-1-enyl)thieno[2,3-b]pyridine-5-carbonitrile |
| SMILES | Cc1c(Nc2c(C#N)cnc3sc(C=CC(=O)N4CCNCC4)cc23)ccc2[nH]ccc12 |
| InChI | InChI=1S/C24H22N6OS/c1-15-18-6-7-27-21(18)4-3-20(15)29-23-16(13-25)14-28-24-19(23)12-17(32-24)2-5-22(31)30-10-8-26-9-11-30/h2-7,12,14,26-27H,8-11H2,1H3,(H,28,29) |
| InChIKey | RTQPLZRMXYMSIQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|