C22H20N4SSi — CID 154161372
4-[(4-methyl-1H-indol-5-yl)amino]-2-(2-trimethylsilylethynyl)thieno[2,3-b]pyridine-5-carbonitrile (PubChem CID 154161372) has the molecular formula C22H20N4SSi and a molecular weight of 400.58 g/mol. Its IUPAC name is 4-[(4-methyl-1H-indol-5-yl)amino]-2-(2-trimethylsilylethynyl)thieno[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 4-[(4-methyl-1H-indol-5-yl)amino]-2-(2-trimethylsilylethynyl)thieno[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 154161372 |
| Molecular Formula | C22H20N4SSi |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 4-[(4-methyl-1H-indol-5-yl)amino]-2-(2-trimethylsilylethynyl)thieno[2,3-b]pyridine-5-carbonitrile |
| SMILES | Cc1c(Nc2c(C#N)cnc3sc(C#C[Si](C)(C)C)cc23)ccc2[nH]ccc12 |
| InChI | InChI=1S/C22H20N4SSi/c1-14-17-7-9-24-20(17)6-5-19(14)26-21-15(12-23)13-25-22-18(21)11-16(27-22)8-10-28(2,3)4/h5-7,9,11,13,24H,1-4H3,(H,25,26) |
| InChIKey | ZUKRRBIBAUEALD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|