C27H28N4OS — CID 18383017
5-[[4-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]phenyl]methylamino]pentan-1-ol (PubChem CID 18383017) has the molecular formula C27H28N4OS and a molecular weight of 456.62 g/mol. Its IUPAC name is 5-[[4-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]phenyl]methylamino]pentan-1-ol.
| Compound Name | 5-[[4-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]phenyl]methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 18383017 |
| Molecular Formula | C27H28N4OS |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 5-[[4-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]phenyl]methylamino]pentan-1-ol |
| SMILES | OCCCCCNCc1ccc(-c2cc3nccc(Nc4ccc5[nH]ccc5c4)c3s2)cc1 |
| InChI | InChI=1S/C27H28N4OS/c32-15-3-1-2-12-28-18-19-4-6-20(7-5-19)26-17-25-27(33-26)24(11-14-30-25)31-22-8-9-23-21(16-22)10-13-29-23/h4-11,13-14,16-17,28-29,32H,1-3,12,15,18H2,(H,30,31) |
| InChIKey | YWYWQWJXJVHOSV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|