C30H33N5O2S — CID 54281657
2-[2-[4-[[4-[7-(1H-indol-5-ylamino)thieno[2,3-c]pyridin-2-yl]phenyl]methyl]piperazin-1-yl]ethoxy]ethanol (PubChem CID 54281657) has the molecular formula C30H33N5O2S and a molecular weight of 527.69 g/mol. Its IUPAC name is 2-[2-[4-[[4-[7-(1H-indol-5-ylamino)thieno[2,3-c]pyridin-2-yl]phenyl]methyl]piperazin-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[[4-[7-(1H-indol-5-ylamino)thieno[2,3-c]pyridin-2-yl]phenyl]methyl]piperazin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 54281657 |
| Molecular Formula | C30H33N5O2S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 2-[2-[4-[[4-[7-(1H-indol-5-ylamino)thieno[2,3-c]pyridin-2-yl]phenyl]methyl]piperazin-1-yl]ethoxy]ethanol |
| SMILES | OCCOCCN1CCN(Cc2ccc(-c3cc4ccnc(Nc5ccc6[nH]ccc6c5)c4s3)cc2)CC1 |
| InChI | InChI=1S/C30H33N5O2S/c36-16-18-37-17-15-34-11-13-35(14-12-34)21-22-1-3-23(4-2-22)28-20-25-8-10-32-30(29(25)38-28)33-26-5-6-27-24(19-26)7-9-31-27/h1-10,19-20,31,36H,11-18,21H2,(H,32,33) |
| InChIKey | RREVNGYWQGCQKQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 76.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|