C26H32N4O4 — CID 167440170
6-[4-[[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methyl]phenyl]-4-(4-methoxyphenyl)-1H-pyrimidin-2-one (PubChem CID 167440170) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 6-[4-[[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methyl]phenyl]-4-(4-methoxyphenyl)-1H-pyrimidin-2-one.
| Compound Name | 6-[4-[[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methyl]phenyl]-4-(4-methoxyphenyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 167440170 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 6-[4-[[4-[2-(2-hydroxyethoxy)ethyl]piperazin-1-yl]methyl]phenyl]-4-(4-methoxyphenyl)-1H-pyrimidin-2-one |
| SMILES | COc1ccc(-c2cc(-c3ccc(CN4CCN(CCOCCO)CC4)cc3)[nH]c(=O)n2)cc1 |
| InChI | InChI=1S/C26H32N4O4/c1-33-23-8-6-22(7-9-23)25-18-24(27-26(32)28-25)21-4-2-20(3-5-21)19-30-12-10-29(11-13-30)14-16-34-17-15-31/h2-9,18,31H,10-17,19H2,1H3,(H,27,28,32) |
| InChIKey | HPWOMAPHQAXPLH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|