C19H26IN3O3 — CID 166367095
2-[2-[2-[(6-methoxynaphthalen-2-yl)methylamino]-4,5-dihydroimidazol-1-yl]ethoxy]ethanol;hydroiodide (PubChem CID 166367095) has the molecular formula C19H26IN3O3 and a molecular weight of 471.34 g/mol. Its IUPAC name is 2-[2-[2-[(6-methoxynaphthalen-2-yl)methylamino]-4,5-dihydroimidazol-1-yl]ethoxy]ethanol;hydroiodide.
| Compound Name | 2-[2-[2-[(6-methoxynaphthalen-2-yl)methylamino]-4,5-dihydroimidazol-1-yl]ethoxy]ethanol;hydroiodide |
|---|---|
| PubChem CID | 166367095 |
| Molecular Formula | C19H26IN3O3 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 2-[2-[2-[(6-methoxynaphthalen-2-yl)methylamino]-4,5-dihydroimidazol-1-yl]ethoxy]ethanol;hydroiodide |
| SMILES | COc1ccc2cc(CNC3=NCCN3CCOCCO)ccc2c1.I |
| InChI | InChI=1S/C19H25N3O3.HI/c1-24-18-5-4-16-12-15(2-3-17(16)13-18)14-21-19-20-6-7-22(19)8-10-25-11-9-23;/h2-5,12-13,23H,6-11,14H2,1H3,(H,20,21);1H |
| InChIKey | QRTUVKCSDKRVJL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|