C14H22IN3O2 — CID 120971952
N-[2-[(4-methoxyphenyl)methoxy]ethyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120971952) has the molecular formula C14H22IN3O2 and a molecular weight of 391.25 g/mol. Its IUPAC name is N-[2-[(4-methoxyphenyl)methoxy]ethyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | N-[2-[(4-methoxyphenyl)methoxy]ethyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120971952 |
| Molecular Formula | C14H22IN3O2 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-[2-[(4-methoxyphenyl)methoxy]ethyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | COc1ccc(COCCNC2=NCCN2C)cc1.I |
| InChI | InChI=1S/C14H21N3O2.HI/c1-17-9-7-15-14(17)16-8-10-19-11-12-3-5-13(18-2)6-4-12;/h3-6H,7-11H2,1-2H3,(H,15,16);1H |
| InChIKey | XMKFZGAWUNWMNR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|