C17H22IN3O — CID 166367127
1-(2-methoxyethyl)-N-(naphthalen-2-ylmethyl)-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 166367127) has the molecular formula C17H22IN3O and a molecular weight of 411.29 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-(naphthalen-2-ylmethyl)-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | 1-(2-methoxyethyl)-N-(naphthalen-2-ylmethyl)-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 166367127 |
| Molecular Formula | C17H22IN3O |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 1-(2-methoxyethyl)-N-(naphthalen-2-ylmethyl)-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | COCCN1CCN=C1NCc1ccc2ccccc2c1.I |
| InChI | InChI=1S/C17H21N3O.HI/c1-21-11-10-20-9-8-18-17(20)19-13-14-6-7-15-4-2-3-5-16(15)12-14;/h2-7,12H,8-11,13H2,1H3,(H,18,19);1H |
| InChIKey | ZTWNGINLQLHPBE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|