C17H22IN3 — CID 166367204
1,5,5-trimethyl-N-(naphthalen-2-ylmethyl)-4H-imidazol-2-amine;hydroiodide (PubChem CID 166367204) has the molecular formula C17H22IN3 and a molecular weight of 395.29 g/mol. Its IUPAC name is 1,5,5-trimethyl-N-(naphthalen-2-ylmethyl)-4H-imidazol-2-amine;hydroiodide.
| Compound Name | 1,5,5-trimethyl-N-(naphthalen-2-ylmethyl)-4H-imidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 166367204 |
| Molecular Formula | C17H22IN3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 1,5,5-trimethyl-N-(naphthalen-2-ylmethyl)-4H-imidazol-2-amine;hydroiodide |
| SMILES | CN1C(NCc2ccc3ccccc3c2)=NCC1(C)C.I |
| InChI | InChI=1S/C17H21N3.HI/c1-17(2)12-19-16(20(17)3)18-11-13-8-9-14-6-4-5-7-15(14)10-13;/h4-10H,11-12H2,1-3H3,(H,18,19);1H |
| InChIKey | SWOVYUPIBJFVON-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|