C18H22IN3 — CID 166367165
1-(cyclopropylmethyl)-N-(naphthalen-2-ylmethyl)-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 166367165) has the molecular formula C18H22IN3 and a molecular weight of 407.30 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-N-(naphthalen-2-ylmethyl)-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | 1-(cyclopropylmethyl)-N-(naphthalen-2-ylmethyl)-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 166367165 |
| Molecular Formula | C18H22IN3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-(cyclopropylmethyl)-N-(naphthalen-2-ylmethyl)-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | I.c1ccc2cc(CNC3=NCCN3CC3CC3)ccc2c1 |
| InChI | InChI=1S/C18H21N3.HI/c1-2-4-17-11-15(7-8-16(17)3-1)12-20-18-19-9-10-21(18)13-14-5-6-14;/h1-4,7-8,11,14H,5-6,9-10,12-13H2,(H,19,20);1H |
| InChIKey | NHDXUFCPGIQUPZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|