C20H13N3OS2 — CID 87848495
4-[4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]thiophene-2-carbaldehyde (PubChem CID 87848495) has the molecular formula C20H13N3OS2 and a molecular weight of 375.48 g/mol. Its IUPAC name is 4-[4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 4-[4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 87848495 |
| Molecular Formula | C20H13N3OS2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 4-[4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1cc(-c2cc3c(Nc4ccc5[nH]ccc5c4)ccnc3s2)cs1 |
| InChI | InChI=1S/C20H13N3OS2/c24-10-15-8-13(11-25-15)19-9-16-18(4-6-22-20(16)26-19)23-14-1-2-17-12(7-14)3-5-21-17/h1-11,21H,(H,22,23) |
| InChIKey | SSJLMXMFFUHDNA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|