C12H11N3S — CID 63655581
N-(1,3-thiazol-2-ylmethyl)-1H-indol-5-amine (PubChem CID 63655581) has the molecular formula C12H11N3S and a molecular weight of 229.31 g/mol. Its IUPAC name is N-(1,3-thiazol-2-ylmethyl)-1H-indol-5-amine.
| Compound Name | N-(1,3-thiazol-2-ylmethyl)-1H-indol-5-amine |
|---|---|
| PubChem CID | 63655581 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | N-(1,3-thiazol-2-ylmethyl)-1H-indol-5-amine |
| SMILES | c1csc(CNc2ccc3[nH]ccc3c2)n1 |
| InChI | InChI=1S/C12H11N3S/c1-2-11-9(3-4-13-11)7-10(1)15-8-12-14-5-6-16-12/h1-7,13,15H,8H2 |
| InChIKey | WUCSDVOIPPAETA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |