C20H28FNOS — CID 22279843
2-amino-4-[5-[5-(4-fluorophenyl)pentyl]thiophen-2-yl]-2-methylbutan-1-ol (PubChem CID 22279843) has the molecular formula C20H28FNOS and a molecular weight of 349.52 g/mol. Its IUPAC name is 2-amino-4-[5-[5-(4-fluorophenyl)pentyl]thiophen-2-yl]-2-methylbutan-1-ol.
| Compound Name | 2-amino-4-[5-[5-(4-fluorophenyl)pentyl]thiophen-2-yl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 22279843 |
| Molecular Formula | C20H28FNOS |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2-amino-4-[5-[5-(4-fluorophenyl)pentyl]thiophen-2-yl]-2-methylbutan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(CCCCCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C20H28FNOS/c1-20(22,15-23)14-13-19-12-11-18(24-19)6-4-2-3-5-16-7-9-17(21)10-8-16/h7-12,23H,2-6,13-15,22H2,1H3 |
| InChIKey | BYQHQGFWMGRISE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|