About oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane
oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane (PubChem CID 22281013) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane.
Molecular Properties
| Compound Name | oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane |
| PubChem CID | 22281013 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane |
| SMILES | C1CO1.C=CCC(OC(CC=C)C1CO1)C1CO1 |
| InChI | InChI=1S/C12H18O3.C2H4O/c1-3-5-9(11-7-13-11)15-10(6-4-2)12-8-14-12;1-2-3-1/h3-4,9-12H,1-2,5-8H2;1-2H2 |
| InChIKey | XWYDTUOWYXZOQH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane?
The IUPAC name of oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane (CID 22281013) is oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane.
What is the SMILES notation for oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane?
The canonical SMILES for oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane is C1CO1.C=CCC(OC(CC=C)C1CO1)C1CO1.
What is the InChIKey of oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane?
The InChIKey is XWYDTUOWYXZOQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3.C2H4O/c1-3-5-9(11-7-13-11)15-10(6-4-2)12-8-14-12;1-2-3-1/h3-4,9-12H,1-2,5-8H2;1-2H2.
What are the key properties of oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane?
oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane has a molecular weight of 254.33 g/mol, XLogP of 1.71, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxirane;2-[1-[1-(oxiran-2-yl)but-3-enoxy]but-3-enyl]oxirane is sourced from PubChem (CID 22281013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).