C12H20O4 — CID 57121799
2-[6-(oxiran-2-ylmethoxy)hex-1-enoxymethyl]oxirane (PubChem CID 57121799) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-[6-(oxiran-2-ylmethoxy)hex-1-enoxymethyl]oxirane.
| Compound Name | 2-[6-(oxiran-2-ylmethoxy)hex-1-enoxymethyl]oxirane |
|---|---|
| PubChem CID | 57121799 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-[6-(oxiran-2-ylmethoxy)hex-1-enoxymethyl]oxirane |
| SMILES | C(=COCC1CO1)CCCCOCC1CO1 |
| InChI | InChI=1S/C12H20O4/c1(3-5-13-7-11-9-15-11)2-4-6-14-8-12-10-16-12/h3,5,11-12H,1-2,4,6-10H2 |
| InChIKey | KQYMPZICQTTXLY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|