C18H27ClN4O5S — CID 22285821
1-[4-methylsulfonyl-2-(pyrrolidin-1-ylmethyl)piperazin-1-yl]-2-(2-nitrophenyl)ethanone;hydrochloride (PubChem CID 22285821) has the molecular formula C18H27ClN4O5S and a molecular weight of 446.96 g/mol. Its IUPAC name is 1-[4-methylsulfonyl-2-(pyrrolidin-1-ylmethyl)piperazin-1-yl]-2-(2-nitrophenyl)ethanone;hydrochloride.
| Compound Name | 1-[4-methylsulfonyl-2-(pyrrolidin-1-ylmethyl)piperazin-1-yl]-2-(2-nitrophenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 22285821 |
| Molecular Formula | C18H27ClN4O5S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-[4-methylsulfonyl-2-(pyrrolidin-1-ylmethyl)piperazin-1-yl]-2-(2-nitrophenyl)ethanone;hydrochloride |
| SMILES | CS(=O)(=O)N1CCN(C(=O)Cc2ccccc2[N+](=O)[O-])C(CN2CCCC2)C1.Cl |
| InChI | InChI=1S/C18H26N4O5S.ClH/c1-28(26,27)20-10-11-21(16(14-20)13-19-8-4-5-9-19)18(23)12-15-6-2-3-7-17(15)22(24)25;/h2-3,6-7,16H,4-5,8-14H2,1H3;1H |
| InChIKey | NNJRRWNDMQWHHQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|