C7H15O3PS-2 — CID 22288128
4-methyl-3-phosphonatohexane-3-thiol (PubChem CID 22288128) has the molecular formula C7H15O3PS-2 and a molecular weight of 210.23 g/mol. Its IUPAC name is 4-methyl-3-phosphonatohexane-3-thiol.
| Compound Name | 4-methyl-3-phosphonatohexane-3-thiol |
|---|---|
| PubChem CID | 22288128 |
| Molecular Formula | C7H15O3PS-2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 4-methyl-3-phosphonatohexane-3-thiol |
| SMILES | CCC(C)C(S)(CC)P(=O)([O-])[O-] |
| InChI | InChI=1S/C7H17O3PS/c1-4-6(3)7(12,5-2)11(8,9)10/h6,12H,4-5H2,1-3H3,(H2,8,9,10)/p-2 |
| InChIKey | VZBJAVXCPUUMTM-UHFFFAOYSA-L |
| XLogP | 0.98 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|