C25H21Cl2N5O3 — CID 22291561
8-[(5-amino-2-chlorobenzoyl)amino]-1-(3-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide;hydrochloride (PubChem CID 22291561) has the molecular formula C25H21Cl2N5O3 and a molecular weight of 510.38 g/mol. Its IUPAC name is 8-[(5-amino-2-chlorobenzoyl)amino]-1-(3-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide;hydrochloride.
| Compound Name | 8-[(5-amino-2-chlorobenzoyl)amino]-1-(3-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 22291561 |
| Molecular Formula | C25H21Cl2N5O3 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 8-[(5-amino-2-chlorobenzoyl)amino]-1-(3-hydroxyphenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1nn(-c2cccc(O)c2)c2c1CCc1ccc(NC(=O)c3cc(N)ccc3Cl)cc1-2 |
| InChI | InChI=1S/C25H20ClN5O3.ClH/c26-21-9-6-14(27)10-20(21)25(34)29-15-7-4-13-5-8-18-22(24(28)33)30-31(23(18)19(13)11-15)16-2-1-3-17(32)12-16;/h1-4,6-7,9-12,32H,5,8,27H2,(H2,28,33)(H,29,34);1H |
| InChIKey | IPRAJGJIRJFICD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|