C17H15F2NO2S — CID 22292884
1-[[4-(3,4-difluorophenoxy)phenyl]methyl]-4-sulfanylpyrrolidin-2-one (PubChem CID 22292884) has the molecular formula C17H15F2NO2S and a molecular weight of 335.38 g/mol. Its IUPAC name is 1-[[4-(3,4-difluorophenoxy)phenyl]methyl]-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-[[4-(3,4-difluorophenoxy)phenyl]methyl]-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 22292884 |
| Molecular Formula | C17H15F2NO2S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 1-[[4-(3,4-difluorophenoxy)phenyl]methyl]-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1Cc1ccc(Oc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H15F2NO2S/c18-15-6-5-13(7-16(15)19)22-12-3-1-11(2-4-12)9-20-10-14(23)8-17(20)21/h1-7,14,23H,8-10H2 |
| InChIKey | GBGQFKYPTBVZJV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|