C19H12FN2O2- — CID 2229665
2-[3-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]indol-1-yl]acetate (PubChem CID 2229665) has the molecular formula C19H12FN2O2- and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]indol-1-yl]acetate.
| Compound Name | 2-[3-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 2229665 |
| Molecular Formula | C19H12FN2O2- |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-[3-[(E)-2-cyano-2-(3-fluorophenyl)ethenyl]indol-1-yl]acetate |
| SMILES | N#C/C(=C/c1cn(CC(=O)[O-])c2ccccc12)c1cccc(F)c1 |
| InChI | InChI=1S/C19H13FN2O2/c20-16-5-3-4-13(9-16)14(10-21)8-15-11-22(12-19(23)24)18-7-2-1-6-17(15)18/h1-9,11H,12H2,(H,23,24)/p-1/b14-8- |
| InChIKey | QBDHYERORHCSLY-ZSOIEALJSA-M |
| XLogP | 2.59 |
| TPSA | 68.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|