C29H46O2 — CID 22296678
[(5R,9R,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate (PubChem CID 22296678) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is [(5R,9R,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate.
| Compound Name | [(5R,9R,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate |
|---|---|
| PubChem CID | 22296678 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | [(5R,9R,10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-7-yl] acetate |
| SMILES | CC(=O)OC1=C2C3=CC[C@H]([C@H](C)CCCC(C)C)[C@@]3(C)CC[C@@H]2[C@@]2(C)CCCC[C@@H]2C1 |
| InChI | InChI=1S/C29H46O2/c1-19(2)10-9-11-20(3)23-13-14-24-27-25(15-17-29(23,24)6)28(5)16-8-7-12-22(28)18-26(27)31-21(4)30/h14,19-20,22-23,25H,7-13,15-18H2,1-6H3/t20-,22-,23-,25+,28+,29-/m1/s1 |
| InChIKey | PONGXNJNLIRVMO-ZXGDWVQUSA-N |
| XLogP | 8.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |