C33H52O6 — CID 91709766
[(3S,5R,7R,9R,10S,13R,15S,17R)-7,15-diacetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 91709766) has the molecular formula C33H52O6 and a molecular weight of 544.77 g/mol. Its IUPAC name is [(3S,5R,7R,9R,10S,13R,15S,17R)-7,15-diacetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5R,7R,9R,10S,13R,15S,17R)-7,15-diacetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 91709766 |
| Molecular Formula | C33H52O6 |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | [(3S,5R,7R,9R,10S,13R,15S,17R)-7,15-diacetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@H](C1)C[C@@H](OC(C)=O)C1=C3[C@@H](OC(C)=O)C[C@H]([C@H](C)CCCC(C)C)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C33H52O6/c1-19(2)10-9-11-20(3)27-18-29(39-23(6)36)31-30-26(13-15-33(27,31)8)32(7)14-12-25(37-21(4)34)16-24(32)17-28(30)38-22(5)35/h19-20,24-29H,9-18H2,1-8H3/t20-,24-,25+,26+,27-,28-,29+,32+,33-/m1/s1 |
| InChIKey | YXLHTEKMYJQGCL-KARDSOAPSA-N |
| XLogP | 7.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|