C23H31FO4 — CID 22296707
[(3S,8R,9S,10R,13S,14S,17R)-17-ethynyl-3-fluoro-5-hydroxy-10,13-dimethyl-6-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 22296707) has the molecular formula C23H31FO4 and a molecular weight of 390.50 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S,17R)-17-ethynyl-3-fluoro-5-hydroxy-10,13-dimethyl-6-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S,17R)-17-ethynyl-3-fluoro-5-hydroxy-10,13-dimethyl-6-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 22296707 |
| Molecular Formula | C23H31FO4 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S,17R)-17-ethynyl-3-fluoro-5-hydroxy-10,13-dimethyl-6-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C#C[C@]1(OC(C)=O)CC[C@H]2[C@@H]3CC(=O)C4(O)C[C@@H](F)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H31FO4/c1-5-22(28-14(2)25)11-8-17-16-12-19(26)23(27)13-15(24)6-9-21(23,4)18(16)7-10-20(17,22)3/h1,15-18,27H,6-13H2,2-4H3/t15-,16-,17-,18-,20-,21+,22-,23?/m0/s1 |
| InChIKey | HQBORZKOJRRGOX-YZDDUPOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|