C23H32O5 — CID 102585181
[(5R,8S,9S,10R,13S,14S)-17-acetyl-5-hydroxy-10,13-dimethyl-6-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 102585181) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is [(5R,8S,9S,10R,13S,14S)-17-acetyl-5-hydroxy-10,13-dimethyl-6-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(5R,8S,9S,10R,13S,14S)-17-acetyl-5-hydroxy-10,13-dimethyl-6-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 102585181 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [(5R,8S,9S,10R,13S,14S)-17-acetyl-5-hydroxy-10,13-dimethyl-6-oxo-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@]2(C)[C@H]3CC[C@]4(C)C(C(C)=O)=CC[C@H]4[C@@H]3CC(=O)[C@@]2(O)C1 |
| InChI | InChI=1S/C23H32O5/c1-13(24)17-5-6-18-16-11-20(26)23(27)12-15(28-14(2)25)7-10-22(23,4)19(16)8-9-21(17,18)3/h5,15-16,18-19,27H,6-12H2,1-4H3/t15?,16-,18-,19-,21+,22+,23-/m0/s1 |
| InChIKey | INSXUACTWWVTQP-KYDVQCTASA-N |
| XLogP | 3.38 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |