C25H34O5 — CID 10525868
[(3S,4R,8R,9S,10R,13S,14S)-17-acetyl-4-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 10525868) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is [(3S,4R,8R,9S,10R,13S,14S)-17-acetyl-4-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,4R,8R,9S,10R,13S,14S)-17-acetyl-4-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 10525868 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | [(3S,4R,8R,9S,10R,13S,14S)-17-acetyl-4-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(C(C)=O)=CC[C@@H]32)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H34O5/c1-14(26)18-8-9-19-17-6-7-21-23(30-16(3)28)22(29-15(2)27)11-13-25(21,5)20(17)10-12-24(18,19)4/h7-8,17,19-20,22-23H,6,9-13H2,1-5H3/t17-,19-,20-,22-,23+,24+,25+/m0/s1 |
| InChIKey | IRSQRPZAXOEOGT-GVSGDTRVSA-N |
| XLogP | 4.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|