C27H41NO6 — CID 23267977
[(3S,10R,13S)-17-acetyl-6-(ethoxycarbonylamino)-5-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 23267977) has the molecular formula C27H41NO6 and a molecular weight of 475.63 g/mol. Its IUPAC name is [(3S,10R,13S)-17-acetyl-6-(ethoxycarbonylamino)-5-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,10R,13S)-17-acetyl-6-(ethoxycarbonylamino)-5-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 23267977 |
| Molecular Formula | C27H41NO6 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | [(3S,10R,13S)-17-acetyl-6-(ethoxycarbonylamino)-5-methoxy-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CCOC(=O)NC1CC2C3CC=C(C(C)=O)[C@@]3(C)CCC2[C@@]2(C)CC[C@H](OC(C)=O)CC12OC |
| InChI | InChI=1S/C27H41NO6/c1-7-33-24(31)28-23-14-19-21-9-8-20(16(2)29)25(21,4)12-11-22(19)26(5)13-10-18(34-17(3)30)15-27(23,26)32-6/h8,18-19,21-23H,7,9-15H2,1-6H3,(H,28,31)/t18-,19?,21?,22?,23?,25+,26+,27?/m0/s1 |
| InChIKey | NAXSTLOZLHEVKF-YVYMECJJSA-N |
| XLogP | 4.58 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |