C25H29N7O4 — CID 22298002
5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-[4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]butoxy]oxolan-3-ol (PubChem CID 22298002) has the molecular formula C25H29N7O4 and a molecular weight of 491.55 g/mol. Its IUPAC name is 5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-[4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]butoxy]oxolan-3-ol.
| Compound Name | 5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-[4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]butoxy]oxolan-3-ol |
|---|---|
| PubChem CID | 22298002 |
| Molecular Formula | C25H29N7O4 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-4-[4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]butoxy]oxolan-3-ol |
| SMILES | Cc1ccnc(-c2cc(CCCCOC3C(O)C(CO)OC3n3cnc4c(N)ncnc43)ccn2)c1 |
| InChI | InChI=1S/C25H29N7O4/c1-15-5-7-27-17(10-15)18-11-16(6-8-28-18)4-2-3-9-35-22-21(34)19(12-33)36-25(22)32-14-31-20-23(26)29-13-30-24(20)32/h5-8,10-11,13-14,19,21-22,25,33-34H,2-4,9,12H2,1H3,(H2,26,29,30) |
| InChIKey | WQWUGUUALHTVHF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 154.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|