C16H19N3O6 — CID 22298024
2-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-formylanilino]ethyl formate (PubChem CID 22298024) has the molecular formula C16H19N3O6 and a molecular weight of 349.34 g/mol. Its IUPAC name is 2-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-formylanilino]ethyl formate.
| Compound Name | 2-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-formylanilino]ethyl formate |
|---|---|
| PubChem CID | 22298024 |
| Molecular Formula | C16H19N3O6 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-N-formylanilino]ethyl formate |
| SMILES | CC(=O)NCC1CN(c2ccc(N(C=O)CCOC=O)cc2)C(=O)O1 |
| InChI | InChI=1S/C16H19N3O6/c1-12(22)17-8-15-9-19(16(23)25-15)14-4-2-13(3-5-14)18(10-20)6-7-24-11-21/h2-5,10-11,15H,6-9H2,1H3,(H,17,22) |
| InChIKey | NRTRDOUIQKIDMM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|