C21H28ClN3O5S — CID 166685633
(Z)-2-(chloromethylsulfanyl)-N-[[3-[4-[2-ethoxyethyl(formyl)amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]pent-2-enamide (PubChem CID 166685633) has the molecular formula C21H28ClN3O5S and a molecular weight of 469.99 g/mol. Its IUPAC name is (Z)-2-(chloromethylsulfanyl)-N-[[3-[4-[2-ethoxyethyl(formyl)amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]pent-2-enamide.
| Compound Name | (Z)-2-(chloromethylsulfanyl)-N-[[3-[4-[2-ethoxyethyl(formyl)amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]pent-2-enamide |
|---|---|
| PubChem CID | 166685633 |
| Molecular Formula | C21H28ClN3O5S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | (Z)-2-(chloromethylsulfanyl)-N-[[3-[4-[2-ethoxyethyl(formyl)amino]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]pent-2-enamide |
| SMILES | CC/C=C(\SCCl)C(=O)NCC1CN(c2ccc(N(C=O)CCOCC)cc2)C(=O)O1 |
| InChI | InChI=1S/C21H28ClN3O5S/c1-3-5-19(31-14-22)20(27)23-12-18-13-25(21(28)30-18)17-8-6-16(7-9-17)24(15-26)10-11-29-4-2/h5-9,15,18H,3-4,10-14H2,1-2H3,(H,23,27)/b19-5- |
| InChIKey | VDWCWULIFHTXHE-IPKBDRFQSA-N |
| XLogP | 3.35 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|