C14H18N4O2S2 — CID 22298615
N-[3-(tert-butylamino)-3-oxo-1-thiophen-2-ylpropyl]thiadiazole-4-carboxamide (PubChem CID 22298615) has the molecular formula C14H18N4O2S2 and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[3-(tert-butylamino)-3-oxo-1-thiophen-2-ylpropyl]thiadiazole-4-carboxamide.
| Compound Name | N-[3-(tert-butylamino)-3-oxo-1-thiophen-2-ylpropyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 22298615 |
| Molecular Formula | C14H18N4O2S2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-[3-(tert-butylamino)-3-oxo-1-thiophen-2-ylpropyl]thiadiazole-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)CC(NC(=O)c1csnn1)c1cccs1 |
| InChI | InChI=1S/C14H18N4O2S2/c1-14(2,3)16-12(19)7-9(11-5-4-6-21-11)15-13(20)10-8-22-18-17-10/h4-6,8-9H,7H2,1-3H3,(H,15,20)(H,16,19) |
| InChIKey | YPDMNBMJCHPEPQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |