C15H20N2OS2 — CID 115356281
N-tert-butyl-2-(dithiophen-2-ylmethylamino)acetamide (PubChem CID 115356281) has the molecular formula C15H20N2OS2 and a molecular weight of 308.47 g/mol. Its IUPAC name is N-tert-butyl-2-(dithiophen-2-ylmethylamino)acetamide.
| Compound Name | N-tert-butyl-2-(dithiophen-2-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 115356281 |
| Molecular Formula | C15H20N2OS2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-tert-butyl-2-(dithiophen-2-ylmethylamino)acetamide |
| SMILES | CC(C)(C)NC(=O)CNC(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C15H20N2OS2/c1-15(2,3)17-13(18)10-16-14(11-6-4-8-19-11)12-7-5-9-20-12/h4-9,14,16H,10H2,1-3H3,(H,17,18) |
| InChIKey | OCAXMIKCNBOJSS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |