C14H19NOS2 — CID 115359283
3-(dithiophen-2-ylmethylamino)-2,2-dimethylpropan-1-ol (PubChem CID 115359283) has the molecular formula C14H19NOS2 and a molecular weight of 281.45 g/mol. Its IUPAC name is 3-(dithiophen-2-ylmethylamino)-2,2-dimethylpropan-1-ol.
| Compound Name | 3-(dithiophen-2-ylmethylamino)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 115359283 |
| Molecular Formula | C14H19NOS2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-(dithiophen-2-ylmethylamino)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)CNC(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C14H19NOS2/c1-14(2,10-16)9-15-13(11-5-3-7-17-11)12-6-4-8-18-12/h3-8,13,15-16H,9-10H2,1-2H3 |
| InChIKey | BJWSKLXIFZJBFD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |