C15H21NO2S2 — CID 106249456
1-(dithiophen-2-ylmethylamino)-4-methoxy-2-methylbutan-2-ol (PubChem CID 106249456) has the molecular formula C15H21NO2S2 and a molecular weight of 311.47 g/mol. Its IUPAC name is 1-(dithiophen-2-ylmethylamino)-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-(dithiophen-2-ylmethylamino)-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 106249456 |
| Molecular Formula | C15H21NO2S2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-(dithiophen-2-ylmethylamino)-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCCC(C)(O)CNC(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C15H21NO2S2/c1-15(17,7-8-18-2)11-16-14(12-5-3-9-19-12)13-6-4-10-20-13/h3-6,9-10,14,16-17H,7-8,11H2,1-2H3 |
| InChIKey | ACUVASCJXPNDSO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |