C17H25NS2 — CID 43788223
N-(dithiophen-2-ylmethyl)-2,4,4-trimethylpentan-2-amine (PubChem CID 43788223) has the molecular formula C17H25NS2 and a molecular weight of 307.53 g/mol. Its IUPAC name is N-(dithiophen-2-ylmethyl)-2,4,4-trimethylpentan-2-amine.
| Compound Name | N-(dithiophen-2-ylmethyl)-2,4,4-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 43788223 |
| Molecular Formula | C17H25NS2 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-(dithiophen-2-ylmethyl)-2,4,4-trimethylpentan-2-amine |
| SMILES | CC(C)(C)CC(C)(C)NC(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C17H25NS2/c1-16(2,3)12-17(4,5)18-15(13-8-6-10-19-13)14-9-7-11-20-14/h6-11,15,18H,12H2,1-5H3 |
| InChIKey | JUASXSFPCRTADU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |