C15H16ClN3O3S — CID 22300039
2-[(4-chlorophenyl)sulfonylmethylamino]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 22300039) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylmethylamino]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylmethylamino]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 22300039 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylmethylamino]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(CNCS(=O)(=O)c1ccc(Cl)cc1)NCc1ccccn1 |
| InChI | InChI=1S/C15H16ClN3O3S/c16-12-4-6-14(7-5-12)23(21,22)11-17-10-15(20)19-9-13-3-1-2-8-18-13/h1-8,17H,9-11H2,(H,19,20) |
| InChIKey | GHHLVGJELHYLJK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |