C22H20Cl2N2O5S — CID 22304597
2-[2-(benzenesulfonyl)-3,4-dichloroanilino]-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 22304597) has the molecular formula C22H20Cl2N2O5S and a molecular weight of 495.38 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-3,4-dichloroanilino]-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[2-(benzenesulfonyl)-3,4-dichloroanilino]-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 22304597 |
| Molecular Formula | C22H20Cl2N2O5S |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-3,4-dichloroanilino]-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CNc2ccc(Cl)c(Cl)c2S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H20Cl2N2O5S/c1-30-18-11-8-14(12-19(18)31-2)26-20(27)13-25-17-10-9-16(23)21(24)22(17)32(28,29)15-6-4-3-5-7-15/h3-12,25H,13H2,1-2H3,(H,26,27) |
| InChIKey | WOBNCGRAWZVLJQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |