C22H22FN3O5S2 — CID 22305356
2-(3-fluoro-2-methylsulfonylanilino)-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 22305356) has the molecular formula C22H22FN3O5S2 and a molecular weight of 491.57 g/mol. Its IUPAC name is 2-(3-fluoro-2-methylsulfonylanilino)-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(3-fluoro-2-methylsulfonylanilino)-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 22305356 |
| Molecular Formula | C22H22FN3O5S2 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 2-(3-fluoro-2-methylsulfonylanilino)-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(NC(=O)CNc3cccc(F)c3S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C22H22FN3O5S2/c1-15-5-3-6-17(13-15)26-33(30,31)18-11-9-16(10-12-18)25-21(27)14-24-20-8-4-7-19(23)22(20)32(2,28)29/h3-13,24,26H,14H2,1-2H3,(H,25,27) |
| InChIKey | TXMZOLAGFIXWFO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |