C29H31N3OS — CID 22306109
N-[(E)-(1-benzylindol-3-yl)methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 22306109) has the molecular formula C29H31N3OS and a molecular weight of 469.65 g/mol. Its IUPAC name is N-[(E)-(1-benzylindol-3-yl)methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(E)-(1-benzylindol-3-yl)methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 22306109 |
| Molecular Formula | C29H31N3OS |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | N-[(E)-(1-benzylindol-3-yl)methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)C1CCc2c(C(=O)N/N=C/c3cn(Cc4ccccc4)c4ccccc34)csc2C1 |
| InChI | InChI=1S/C29H31N3OS/c1-29(2,3)22-13-14-24-25(19-34-27(24)15-22)28(33)31-30-16-21-18-32(17-20-9-5-4-6-10-20)26-12-8-7-11-23(21)26/h4-12,16,18-19,22H,13-15,17H2,1-3H3,(H,31,33)/b30-16+ |
| InChIKey | GNKJTAIDPKPGPC-OKCVXOCRSA-N |
| XLogP | 6.67 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|