C17H22N4OS — CID 22308287
1-cyclohexyl-1-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]urea (PubChem CID 22308287) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 1-cyclohexyl-1-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]urea.
| Compound Name | 1-cyclohexyl-1-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]urea |
|---|---|
| PubChem CID | 22308287 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-cyclohexyl-1-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]urea |
| SMILES | Cc1ccc(-c2csc(NN(C(N)=O)C3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C17H22N4OS/c1-12-7-9-13(10-8-12)15-11-23-17(19-15)20-21(16(18)22)14-5-3-2-4-6-14/h7-11,14H,2-6H2,1H3,(H2,18,22)(H,19,20) |
| InChIKey | WDLYGCKXLRDSNH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|