C22H14FNO4 — CID 22311034
3-[4-[(1,3-dioxoisoindol-2-yl)methyl]-3-fluorophenyl]benzoic acid (PubChem CID 22311034) has the molecular formula C22H14FNO4 and a molecular weight of 375.36 g/mol. Its IUPAC name is 3-[4-[(1,3-dioxoisoindol-2-yl)methyl]-3-fluorophenyl]benzoic acid.
| Compound Name | 3-[4-[(1,3-dioxoisoindol-2-yl)methyl]-3-fluorophenyl]benzoic acid |
|---|---|
| PubChem CID | 22311034 |
| Molecular Formula | C22H14FNO4 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 3-[4-[(1,3-dioxoisoindol-2-yl)methyl]-3-fluorophenyl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ccc(CN3C(=O)c4ccccc4C3=O)c(F)c2)c1 |
| InChI | InChI=1S/C22H14FNO4/c23-19-11-14(13-4-3-5-15(10-13)22(27)28)8-9-16(19)12-24-20(25)17-6-1-2-7-18(17)21(24)26/h1-11H,12H2,(H,27,28) |
| InChIKey | UAOINLKWAXTRHY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|