C10H12I2O2 — CID 22313365
1-(2,4-diiodophenoxy)butan-2-ol (PubChem CID 22313365) has the molecular formula C10H12I2O2 and a molecular weight of 418.01 g/mol. Its IUPAC name is 1-(2,4-diiodophenoxy)butan-2-ol.
| Compound Name | 1-(2,4-diiodophenoxy)butan-2-ol |
|---|---|
| PubChem CID | 22313365 |
| Molecular Formula | C10H12I2O2 |
| Molecular Weight | 418.01 g/mol |
| Exact Mass | 417.89 |
| IUPAC Name | 1-(2,4-diiodophenoxy)butan-2-ol |
| SMILES | CCC(O)COc1ccc(I)cc1I |
| InChI | InChI=1S/C10H12I2O2/c1-2-8(13)6-14-10-4-3-7(11)5-9(10)12/h3-5,8,13H,2,6H2,1H3 |
| InChIKey | FLLCJSALZSCICW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.01 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|