C23H23F3O3S — CID 22314040
2-[2-[[2-methyl-3-[4-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]oxy]ethoxy]oxane (PubChem CID 22314040) has the molecular formula C23H23F3O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 2-[2-[[2-methyl-3-[4-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]oxy]ethoxy]oxane.
| Compound Name | 2-[2-[[2-methyl-3-[4-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]oxy]ethoxy]oxane |
|---|---|
| PubChem CID | 22314040 |
| Molecular Formula | C23H23F3O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[2-[[2-methyl-3-[4-(trifluoromethyl)phenyl]-1-benzothiophen-6-yl]oxy]ethoxy]oxane |
| SMILES | Cc1sc2cc(OCCOC3CCCCO3)ccc2c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H23F3O3S/c1-15-22(16-5-7-17(8-6-16)23(24,25)26)19-10-9-18(14-20(19)30-15)27-12-13-29-21-4-2-3-11-28-21/h5-10,14,21H,2-4,11-13H2,1H3 |
| InChIKey | UYUOYPOFITUZJP-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|