C18H15F4N5O2S2 — CID 22315528
1-[4-fluoro-3-[1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]-1-methylthiourea (PubChem CID 22315528) has the molecular formula C18H15F4N5O2S2 and a molecular weight of 473.48 g/mol. Its IUPAC name is 1-[4-fluoro-3-[1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]-1-methylthiourea.
| Compound Name | 1-[4-fluoro-3-[1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]-1-methylthiourea |
|---|---|
| PubChem CID | 22315528 |
| Molecular Formula | C18H15F4N5O2S2 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 1-[4-fluoro-3-[1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]phenyl]-1-methylthiourea |
| SMILES | CN(C(N)=S)c1ccc(F)c(-c2cc(C(F)(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H15F4N5O2S2/c1-26(17(23)30)11-4-7-14(19)13(8-11)15-9-16(18(20,21)22)25-27(15)10-2-5-12(6-3-10)31(24,28)29/h2-9H,1H3,(H2,23,30)(H2,24,28,29) |
| InChIKey | CCHRUIHQDBDCRC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|