C15H18N2O7S — CID 2231639
(2S)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]pentanedioic acid (PubChem CID 2231639) has the molecular formula C15H18N2O7S and a molecular weight of 370.38 g/mol. Its IUPAC name is (2S)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 2231639 |
| Molecular Formula | C15H18N2O7S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | (2S)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NS(=O)(=O)c1ccc(N2CCCC2=O)cc1)C(=O)O |
| InChI | InChI=1S/C15H18N2O7S/c18-13-2-1-9-17(13)10-3-5-11(6-4-10)25(23,24)16-12(15(21)22)7-8-14(19)20/h3-6,12,16H,1-2,7-9H2,(H,19,20)(H,21,22)/t12-/m0/s1 |
| InChIKey | ROGAJZHDVHKHCG-LBPRGKRZSA-N |
| XLogP | 0.41 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |