C19H13F7N2O5S2 — CID 22316867
[4-[1-(3-fluoro-4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-2-methylphenyl] trifluoromethanesulfonate (PubChem CID 22316867) has the molecular formula C19H13F7N2O5S2 and a molecular weight of 546.44 g/mol. Its IUPAC name is [4-[1-(3-fluoro-4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-2-methylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-[1-(3-fluoro-4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-2-methylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22316867 |
| Molecular Formula | C19H13F7N2O5S2 |
| Molecular Weight | 546.44 g/mol |
| Exact Mass | 546.02 |
| IUPAC Name | [4-[1-(3-fluoro-4-methylsulfonylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]-2-methylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(-c2cc(C(F)(F)F)nn2-c2ccc(S(C)(=O)=O)c(F)c2)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H13F7N2O5S2/c1-10-7-11(3-5-15(10)33-35(31,32)19(24,25)26)14-9-17(18(21,22)23)27-28(14)12-4-6-16(13(20)8-12)34(2,29)30/h3-9H,1-2H3 |
| InChIKey | UHJLOAXORXISDA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|