C14H12N2O4 — CID 22317204
3-[3-(6-methoxypyridazin-3-yl)phenyl]-3-oxopropanoic acid (PubChem CID 22317204) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 3-[3-(6-methoxypyridazin-3-yl)phenyl]-3-oxopropanoic acid.
| Compound Name | 3-[3-(6-methoxypyridazin-3-yl)phenyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 22317204 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-[3-(6-methoxypyridazin-3-yl)phenyl]-3-oxopropanoic acid |
| SMILES | COc1ccc(-c2cccc(C(=O)CC(=O)O)c2)nn1 |
| InChI | InChI=1S/C14H12N2O4/c1-20-13-6-5-11(15-16-13)9-3-2-4-10(7-9)12(17)8-14(18)19/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | KVAJYLGPKMLWJI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|