3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid

C17H16O5 — CID 170887228

IUPAC3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid
SMILESCOc1ccc(-c2cccc(C(=O)CC(=O)O)c2)cc1OC
InChIInChI=1S/C17H16O5/c1-21-15-7-6-12(9-16(15)22-2)11-4-3-5-13(8-11)14(18)10-17(19)20/h3-9H,10H2,1-2H3,(H,19,20)
InChIKeyJZBRDJXFXKIZRV-UHFFFAOYSA-N
MW300.31 g/mol
LogP3.03
Rot. Bonds6

About 3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid

3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid (PubChem CID 170887228) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid.

Molecular Properties

Compound Name3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid
PubChem CID170887228
Molecular FormulaC17H16O5
Molecular Weight300.31 g/mol
Exact Mass300.10
IUPAC Name3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid
SMILESCOc1ccc(-c2cccc(C(=O)CC(=O)O)c2)cc1OC
InChIInChI=1S/C17H16O5/c1-21-15-7-6-12(9-16(15)22-2)11-4-3-5-13(8-11)14(18)10-17(19)20/h3-9H,10H2,1-2H3,(H,19,20)
InChIKeyJZBRDJXFXKIZRV-UHFFFAOYSA-N
XLogP3.03
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.31
LogP ≤ 53.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid?
The IUPAC name of 3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid (CID 170887228) is 3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid.
What is the SMILES notation for 3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid?
The canonical SMILES for 3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid is COc1ccc(-c2cccc(C(=O)CC(=O)O)c2)cc1OC.
What is the InChIKey of 3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid?
The InChIKey is JZBRDJXFXKIZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O5/c1-21-15-7-6-12(9-16(15)22-2)11-4-3-5-13(8-11)14(18)10-17(19)20/h3-9H,10H2,1-2H3,(H,19,20).
What are the key properties of 3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid?
3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid has a molecular weight of 300.31 g/mol, XLogP of 3.03, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3,4-dimethoxyphenyl)phenyl]-3-oxopropanoic acid is sourced from PubChem (CID 170887228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).